|
CAS#: 93920-37-7 Product: 3-(o-Toluidino)Phenol Sulphate No suppilers available for the product. |
| Name | 3-(o-Toluidino)Phenol Sulphate |
|---|---|
| Synonyms | 3-(O-Tolylamino)Phenol Sulfate; 3-(O-Toluidino)Phenol Sulfate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13NO5S |
| Molecular Weight | 295.31 |
| CAS Registry Number | 93920-37-7 |
| EINECS | 300-123-2 |
| SMILES | O=[S]([O-])([O-])=O.C1=C(O)C=CC=C1NC2=C(C=CC=C2)C |
| InChI | 1S/C13H13NO.H2O4S/c1-10-5-2-3-8-13(10)14-11-6-4-7-12(15)9-11;1-5(2,3)4/h2-9,14-15H,1H3;(H2,1,2,3,4)/p-2 |
| InChIKey | UPPOYKVRYYAJIK-UHFFFAOYSA-L |
| Boiling point | 343.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 139.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(o-Toluidino)Phenol Sulphate |