|
CAS#: 93942-47-3 Product: 1-[5-(tert-Butyl)-2-Methylphenyl]-2-Buten-1-One No suppilers available for the product. |
| Name | 1-[5-(tert-Butyl)-2-Methylphenyl]-2-Buten-1-One |
|---|---|
| Synonyms | (E)-1-(5-Tert-Butyl-2-Methyl-Phenyl)But-2-En-1-One; 1-(5-(Tert-Butyl)-2-Methylphenyl)-2-Buten-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 |
| CAS Registry Number | 93942-47-3 |
| EINECS | 300-600-5 |
| SMILES | C1=C(C(C)(C)C)C=CC(=C1C(=O)\C=C\C)C |
| InChI | 1S/C15H20O/c1-6-7-14(16)13-10-12(15(3,4)5)9-8-11(13)2/h6-10H,1-5H3/b7-6+ |
| InChIKey | VJEAIPXARJXWIU-VOTSOKGWSA-N |
| Density | 0.938g/cm3 (Cal.) |
|---|---|
| Boiling point | 318.242°C at 760 mmHg (Cal.) |
| Flash point | 132.506°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[5-(tert-Butyl)-2-Methylphenyl]-2-Buten-1-One |