|
CAS#: 93942-51-9 Product: 1-(4,7,7-Trimethylbicyclo[4.1.0]hept-3-en-3-yl)-2-buten-1-one No suppilers available for the product. |
| Name | 1-(4,7,7-Trimethylbicyclo[4.1.0]hept-3-en-3-yl)-2-buten-1-one |
|---|---|
| Synonyms | 1-(4,7,7- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 |
| CAS Registry Number | 93942-51-9 |
| EINECS | 300-604-7 |
| SMILES | CC2(C)C1CC(/C)=C(\CC12)C(=O)C=CC |
| InChI | 1S/C14H20O/c1-5-6-13(15)10-8-12-11(7-9(10)2)14(12,3)4/h5-6,11-12H,7-8H2,1-4H3 |
| InChIKey | VRAUAPMNLFSVNI-UHFFFAOYSA-N |
| Density | 0.969g/cm3 (Cal.) |
|---|---|
| Boiling point | 287.776°C at 760 mmHg (Cal.) |
| Flash point | 117.14°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4,7,7-Trimethylbicyclo[4.1.0]hept-3-en-3-yl)-2-buten-1-one |