|
CAS#: 94021-65-5 Product: 1-(3,4-Dimethyltricyclo[5.2.1.02,6]dec-4-en-3-yl)ethanone No suppilers available for the product. |
| Name | 1-(3,4-Dimethyltricyclo[5.2.1.02,6]dec-4-en-3-yl)ethanone |
|---|---|
| Synonyms | 1-(3a,4,5 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 |
| CAS Registry Number | 94021-65-5 |
| EINECS | 301-460-8 |
| SMILES | CC(=O)C3(C)C(C)=CC2C3C1CC2CC1 |
| InChI | 1S/C14H20O/c1-8-6-12-10-4-5-11(7-10)13(12)14(8,3)9(2)15/h6,10-13H,4-5,7H2,1-3H3 |
| InChIKey | KIQFRSHDORGMDP-UHFFFAOYSA-N |
| Density | 1.02g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.199°C at 760 mmHg (Cal.) |
| Flash point | 115.176°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3,4-Dimethyltricyclo[5.2.1.02,6]dec-4-en-3-yl)ethanone |