|
CAS#: 94021-97-3 Product: 2-Methyl-4-Oxo-4H-Pyran-3-Yl Isovalerate No suppilers available for the product. |
| Name | 2-Methyl-4-Oxo-4H-Pyran-3-Yl Isovalerate |
|---|---|
| Synonyms | (2-Methyl-4-Oxo-Pyran-3-Yl) 3-Methylbutanoate; 3-Methylbutanoic Acid (2-Methyl-4-Oxo-3-Pyranyl) Ester; 3-Methylbutyric Acid (4-Keto-2-Methyl-Pyran-3-Yl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 |
| CAS Registry Number | 94021-97-3 |
| EINECS | 301-489-6 |
| SMILES | C(C(C)C)C(OC1=C(OC=CC1=O)C)=O |
| InChI | 1S/C11H14O4/c1-7(2)6-10(13)15-11-8(3)14-5-4-9(11)12/h4-5,7H,6H2,1-3H3 |
| InChIKey | RUJFQPWLSZMPNC-UHFFFAOYSA-N |
| Density | 1.134g/cm3 (Cal.) |
|---|---|
| Boiling point | 335.793°C at 760 mmHg (Cal.) |
| Flash point | 148.325°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-4-Oxo-4H-Pyran-3-Yl Isovalerate |