|
CAS#: 94088-16-1 Product: 2,2'-Methylenebis(5-bromo-5-nitro-1,3-dioxane) No suppilers available for the product. |
| Name | 2,2'-Methylenebis(5-bromo-5-nitro-1,3-dioxane) |
|---|---|
| Synonyms | 2,2'-methylenebis[5-bromo-5-nitro-1,3-dioxane] |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12Br2N2O8 |
| Molecular Weight | 436.01 |
| CAS Registry Number | 94088-16-1 |
| EINECS | 302-014-5 |
| SMILES | [O-][N+](=O)C1(Br)COC(OC1)CC2OCC(Br)(CO2)[N+]([O-])=O |
| InChI | 1S/C9H12Br2N2O8/c10-8(12(14)15)2-18-6(19-3-8)1-7-20-4-9(11,5-21-7)13(16)17/h6-7H,1-5H2 |
| InChIKey | IKKTUSZWZQTPMM-UHFFFAOYSA-N |
| Density | 2g/cm3 (Cal.) |
|---|---|
| Boiling point | 523.032°C at 760 mmHg (Cal.) |
| Flash point | 270.121°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-Methylenebis(5-bromo-5-nitro-1,3-dioxane) |