Online Database of Chemicals from Around the World
|
CAS#: 94105-89-2 Product: 6,7,4'-Trihydroxyisoflavan No suppilers available for the product. |
| Name | 6,7,4'-Trihydroxyisoflavan |
|---|---|
| Synonyms | 6,7,4'-Trihydroxyisoflavan; 2H-1-Benzopyran-6,7-Diol, 3,4-Dihydro-3-(4-Hydroxyphenyl)- |
| Molecular Structure |  |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 |
| CAS Registry Number | 94105-89-2 |
| SMILES | C1=C(O)C(=CC3=C1CC(C2=CC=C(O)C=C2)CO3)O |
| InChI | 1S/C15H14O4/c16-12-3-1-9(2-4-12)11-5-10-6-13(17)14(18)7-15(10)19-8-11/h1-4,6-7,11,16-18H,5,8H2 |
| InChIKey | NLIIKGCVOJPMQB-UHFFFAOYSA-N |
| Density | 1.383g/cm3 (Cal.) |
|---|---|
| Boiling point | 501.899°C at 760 mmHg (Cal.) |
| Flash point | 257.339°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7,4'-Trihydroxyisoflavan |