|
CAS#: 94107-58-1 Product: 2-Amino-2-Phenylbutyric Acid Hydrochloride No suppilers available for the product. |
| Name | 2-Amino-2-Phenylbutyric Acid Hydrochloride |
|---|---|
| Synonyms | 2-Amino-2-Phenyl-Butanoic Acid Hydrochloride; 2-Amino-2-Phenyl-Butyric Acid Hydrochloride; 2-Amino-2-Phenylbutyric Acid Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight | 215.68 |
| CAS Registry Number | 94107-58-1 |
| EINECS | 302-291-2 |
| SMILES | [H+].C1=C(C(N)(CC)C(O)=O)C=CC=C1.[Cl-] |
| InChI | 1S/C10H13NO2.ClH/c1-2-10(11,9(12)13)8-6-4-3-5-7-8;/h3-7H,2,11H2,1H3,(H,12,13);1H |
| InChIKey | CFJWRBRHIGYHTE-UHFFFAOYSA-N |
| Boiling point | 312.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 142.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-2-Phenylbutyric Acid Hydrochloride |