|
CAS#: 94107-54-7 Product: 5-Bromo-2-Phenyl-3-(2-Pyridyl)-1H-Indole No suppilers available for the product. |
| Name | 5-Bromo-2-Phenyl-3-(2-Pyridyl)-1H-Indole |
|---|---|
| Synonyms | 5-Bromo-2-Phenyl-3-(2-Pyridyl)-1H-Indole |
| Molecular Structure | ![]() |
| Molecular Formula | C19H13BrN2 |
| Molecular Weight | 349.23 |
| CAS Registry Number | 94107-54-7 |
| EINECS | 302-287-0 |
| SMILES | C1=C(Br)C=CC2=C1C(=C([NH]2)C3=CC=CC=C3)C4=NC=CC=C4 |
| InChI | 1S/C19H13BrN2/c20-14-9-10-16-15(12-14)18(17-8-4-5-11-21-17)19(22-16)13-6-2-1-3-7-13/h1-12,22H |
| InChIKey | XFAMYNHHENIARL-UHFFFAOYSA-N |
| Density | 1.444g/cm3 (Cal.) |
|---|---|
| Boiling point | 505.814°C at 760 mmHg (Cal.) |
| Flash point | 259.707°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Bromo-2-Phenyl-3-(2-Pyridyl)-1H-Indole |