|
CAS#: 94107-60-5 Product: 1,4-Dihydro-6-Nitro-2H-3,1-Benzoxazin-2-One No suppilers available for the product. |
| Name | 1,4-Dihydro-6-Nitro-2H-3,1-Benzoxazin-2-One |
|---|---|
| Synonyms | 1,4-Dihydro-6-Nitro-2H-3,1-Benzoxazin-2-One |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6N2O4 |
| Molecular Weight | 194.15 |
| CAS Registry Number | 94107-60-5 |
| EINECS | 302-293-3 |
| SMILES | C1=C2C(=CC=C1[N+]([O-])=O)NC(OC2)=O |
| InChI | 1S/C8H6N2O4/c11-8-9-7-2-1-6(10(12)13)3-5(7)4-14-8/h1-3H,4H2,(H,9,11) |
| InChIKey | NLLUNRCIKRPYMQ-UHFFFAOYSA-N |
| Density | 1.474g/cm3 (Cal.) |
|---|---|
| Boiling point | 297.06°C at 760 mmHg (Cal.) |
| Flash point | 133.458°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Dihydro-6-Nitro-2H-3,1-Benzoxazin-2-One |