|
CAS#: 94107-84-3 Product: 1,4-Bis(1,1-Dimethylethyl)-2,5-Dimethylcyclohexane No suppilers available for the product. |
| Name | 1,4-Bis(1,1-Dimethylethyl)-2,5-Dimethylcyclohexane |
|---|---|
| Synonyms | 1,4-Ditert-Butyl-2,5-Dimethyl-Cyclohexane; 1,4-Bis(1,1-Dimethylethyl)-2,5-Dimethylcyclohexane |
| Molecular Structure | ![]() |
| Molecular Formula | C16H32 |
| Molecular Weight | 224.43 |
| CAS Registry Number | 94107-84-3 |
| EINECS | 302-320-9 |
| SMILES | CC(C1C(CC(C(C)(C)C)C(C1)C)C)(C)C |
| InChI | 1S/C16H32/c1-11-9-14(16(6,7)8)12(2)10-13(11)15(3,4)5/h11-14H,9-10H2,1-8H3 |
| InChIKey | FQDMLHIUVNVOCP-UHFFFAOYSA-N |
| Density | 0.805g/cm3 (Cal.) |
|---|---|
| Boiling point | 262.833°C at 760 mmHg (Cal.) |
| Flash point | 110.277°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Bis(1,1-Dimethylethyl)-2,5-Dimethylcyclohexane |