|
CAS#: 94107-71-8 Product: P,P'-[(heptylimino)bis(methylene)]bis-Phosphonate ammonium salt (1:2) No suppilers available for the product. |
| Name | P,P'-[(heptylimino)bis(methylene)]bis-Phosphonate ammonium salt (1:2) |
|---|---|
| Synonyms | diammoniu |
| Molecular Structure | ![]() |
| Molecular Formula | C9H27N3O6P2 |
| Molecular Weight | 335.28 |
| CAS Registry Number | 94107-71-8 |
| EINECS | 302-306-2 |
| SMILES | [NH4+].[NH4+].[O-]P([O-])(=O)CN(CP(=O)([O-])[O-])CCCCCCC |
| InChI | 1S/C9H23NO6P2.2H3N/c1-2-3-4-5-6-7-10(8-17(11,12)13)9-18(14,15)16;;/h2-9H2,1H3,(H2,11,12,13)(H2,14,15,16);2*1H3/p-2 |
| InChIKey | GCKPSOJHDQNKOM-UHFFFAOYSA-L |
| Boiling point | 605°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 319.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for P,P'-[(heptylimino)bis(methylene)]bis-Phosphonate ammonium salt (1:2) |