|
CAS#: 94109-60-1 Product: Bis{N-benzyl-N-[2-(3,5-dihydroxyphenyl)-2-oxoethyl]-2-propanaminium} sulfate No suppilers available for the product. |
| Name | Bis{N-benzyl-N-[2-(3,5-dihydroxyphenyl)-2-oxoethyl]-2-propanaminium} sulfate |
|---|---|
| Synonyms | bis[benzy |
| Molecular Structure | ![]() |
| Molecular Formula | C36H44N2O10S |
| Molecular Weight | 696.81 |
| CAS Registry Number | 94109-60-1 |
| EINECS | 302-501-2 |
| SMILES | Oc1cc(cc(O)c1)C(=O)C[NH+](Cc2ccccc2)C(C)C.[O-]S([O-])(=O)=O.CC(C)[NH+](Cc1ccccc1)CC(=O)c2cc(O)cc(O)c2 |
| InChI | 1S/2C18H21NO3.H2O4S/c2*1-13(2)19(11-14-6-4-3-5-7-14)12-18(22)15-8-16(20)10-17(21)9-15;1-5(2,3)4/h2*3-10,13,20-21H,11-12H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | JBVHZLPYBQHUQH-UHFFFAOYSA-N |
| Boiling point | 871.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 480.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis{N-benzyl-N-[2-(3,5-dihydroxyphenyl)-2-oxoethyl]-2-propanaminium} sulfate |