|
CAS#: 94129-85-8 Product: Antibiotic G 2N No suppilers available for the product. |
| Name | Antibiotic G 2N |
|---|---|
| Synonyms | G 2N; G-2N; Antibiotic G 2N |
| Molecular Structure | ![]() |
| Molecular Formula | C23H16O6 |
| Molecular Weight | 388.38 |
| CAS Registry Number | 94129-85-8 |
| SMILES | C1=C4C(=C(O)C2=C1C(=O)C3=C(C2=O)C(=CC(=C3)O)O)CCC5=C4C(=CC(=C5)C)O |
| InChI | 1S/C23H16O6/c1-9-4-10-2-3-12-13(18(10)16(25)5-9)8-15-20(22(12)28)23(29)19-14(21(15)27)6-11(24)7-17(19)26/h4-8,24-26,28H,2-3H2,1H3 |
| InChIKey | LWERGSAPTOUIHZ-UHFFFAOYSA-N |
| Density | 1.581g/cm3 (Cal.) |
|---|---|
| Boiling point | 737.146°C at 760 mmHg (Cal.) |
| Flash point | 413.548°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Antibiotic G 2N |