|
CAS#: 94134-95-9 Product: Butyl (17beta)-3-oxoandrost-4-en-17-yl 1,4-cyclohexanedicarboxylate No suppilers available for the product. |
| Name | Butyl (17beta)-3-oxoandrost-4-en-17-yl 1,4-cyclohexanedicarboxylate |
|---|---|
| Synonyms | (17β)-17- |
| Molecular Structure | ![]() |
| Molecular Formula | C31H46O5 |
| Molecular Weight | 498.69 |
| CAS Registry Number | 94134-95-9 |
| EINECS | 302-865-2 |
| SMILES | CCCCOC(=O)C1CCC(CC1)C(=O)O[C@H]3CC[C@H]2[C@@H]4CCC5=CC(=O)CC[C@]5(C)[C@H]4CC[C@@]23C |
| InChI | 1S/C31H46O5/c1-4-5-18-35-28(33)20-6-8-21(9-7-20)29(34)36-27-13-12-25-24-11-10-22-19-23(32)14-16-30(22,2)26(24)15-17-31(25,27)3/h19-21,24-27H,4-18H2,1-3H3/t20?,21?,24-,25-,26-,27-,30-,31-/m0/s1 |
| InChIKey | GNQXIHJIIJLHQI-YYAIDKQPSA-N |
| Density | 1.129g/cm3 (Cal.) |
|---|---|
| Boiling point | 590.028°C at 760 mmHg (Cal.) |
| Flash point | 246.676°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Butyl (17beta)-3-oxoandrost-4-en-17-yl 1,4-cyclohexanedicarboxylate |