|
CAS#: 94135-31-6 Product: (11beta,16beta)-9-Fluoro-11,17-dihydroxy-16-methyl-3,20-dioxopregna-1,4-dien-21-yl isonicotinate No suppilers available for the product. |
| Name | (11beta,16beta)-9-Fluoro-11,17-dihydroxy-16-methyl-3,20-dioxopregna-1,4-dien-21-yl isonicotinate |
|---|---|
| Synonyms | 9-fluoro- |
| Molecular Structure | ![]() |
| Molecular Formula | C28H32FNO6 |
| Molecular Weight | 497.56 |
| CAS Registry Number | 94135-31-6 |
| EINECS | 302-900-1 |
| SMILES | O=C(OCC(=O)[C@@]3(O)[C@@H](C)C[C@H]2[C@@H]4CCC1=CC(=O)C=C[C@]1(C)[C@@]4(F)[C@@H](O)C[C@@]23C)c5ccncc5 |
| InChI | 1S/C28H32FNO6/c1-16-12-21-20-5-4-18-13-19(31)6-9-25(18,2)27(20,29)22(32)14-26(21,3)28(16,35)23(33)15-36-24(34)17-7-10-30-11-8-17/h6-11,13,16,20-22,32,35H,4-5,12,14-15H2,1-3H3/t16-,20-,21-,22-,25-,26-,27-,28-/m0/s1 |
| InChIKey | BQTXJHAJMDGOFI-QEVRMTOFSA-N |
| Density | 1.348g/cm3 (Cal.) |
|---|---|
| Boiling point | 675.964°C at 760 mmHg (Cal.) |
| Flash point | 362.61°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (11beta,16beta)-9-Fluoro-11,17-dihydroxy-16-methyl-3,20-dioxopregna-1,4-dien-21-yl isonicotinate |