|
CAS#: 94135-06-5 Product: 4-Acetoxy-3,20-dioxopregn-4-en-17-yl hexanoate No suppilers available for the product. |
| Name | 4-Acetoxy-3,20-dioxopregn-4-en-17-yl hexanoate |
|---|---|
| Synonyms | 4,17-dihydroxypregn-4-ene-3,20-dione 4-acetate 17-hexanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C29H42O6 |
| Molecular Weight | 486.64 |
| CAS Registry Number | 94135-06-5 |
| EINECS | 302-874-1 |
| SMILES | CC(=O)OC3=C4CC[C@@H]2[C@H](CC[C@@]1(C)[C@H]2CC[C@]1(OC(=O)CCCCC)C(C)=O)[C@@]4(C)CCC3=O |
| InChI | 1S/C29H42O6/c1-6-7-8-9-25(33)35-29(18(2)30)17-13-22-20-10-11-23-26(34-19(3)31)24(32)14-15-27(23,4)21(20)12-16-28(22,29)5/h20-22H,6-17H2,1-5H3/t20-,21+,22+,27-,28+,29+/m1/s1 |
| InChIKey | WRZVFSQVZDEDIK-NTLFILIOSA-N |
| Density | 1.149g/cm3 (Cal.) |
|---|---|
| Boiling point | 594.652°C at 760 mmHg (Cal.) |
| Flash point | 250.112°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Acetoxy-3,20-dioxopregn-4-en-17-yl hexanoate |