|
CAS#: 94199-89-0 Product: [(1R,2R,3R)-1-[(1S)-2-(2-bromoacetyl)oxy-1-hydroxy-ethyl]-2,3,4-trihydroxy-butyl] 2-bromoacetate No suppilers available for the product. |
| Name | [(1R,2R,3R)-1-[(1S)-2-(2-bromoacetyl)oxy-1-hydroxy-ethyl]-2,3,4-trihydroxy-butyl] 2-bromoacetate |
|---|---|
| Synonyms | D-glucitol 1,3-bis(bromoacetate) |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16Br2O8 |
| Molecular Weight | 424.04 |
| CAS Registry Number | 94199-89-0 |
| EINECS | 303-465-0 |
| SMILES | O[C@@H]([C@H](OC(=O)CBr)[C@@H](O)COC(=O)CBr)[C@H](O)CO |
| InChI | 1S/C10H16Br2O8/c11-1-7(16)19-4-6(15)10(20-8(17)2-12)9(18)5(14)3-13/h5-6,9-10,13-15,18H,1-4H2/t5-,6+,9-,10-/m1/s1 |
| InChIKey | NCROLHPKBLFQFE-MLTZYSBQSA-N |
| Density | 1.941g/cm3 (Cal.) |
|---|---|
| Boiling point | 594.567°C at 760 mmHg (Cal.) |
| Flash point | 313.383°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(1R,2R,3R)-1-[(1S)-2-(2-bromoacetyl)oxy-1-hydroxy-ethyl]-2,3,4-trihydroxy-butyl] 2-bromoacetate |