|
CAS#: 94201-83-9 Product: 1,3-Bis[2-(Dimethylamino)Phenyl]Urea No suppilers available for the product. |
| Name | 1,3-Bis[2-(Dimethylamino)Phenyl]Urea |
|---|---|
| Synonyms | 1,3-Bis(2-(Dimethylamino)Phenyl)Urea |
| Molecular Structure | ![]() |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 |
| CAS Registry Number | 94201-83-9 |
| EINECS | 303-673-1 |
| SMILES | C2=C(NC(=O)NC1=C(N(C)C)C=CC=C1)C(=CC=C2)N(C)C |
| InChI | 1S/C17H22N4O/c1-20(2)15-11-7-5-9-13(15)18-17(22)19-14-10-6-8-12-16(14)21(3)4/h5-12H,1-4H3,(H2,18,19,22) |
| InChIKey | ABIBJGOSWOUGGV-UHFFFAOYSA-N |
| Density | 1.214g/cm3 (Cal.) |
|---|---|
| Boiling point | 359.967°C at 760 mmHg (Cal.) |
| Flash point | 171.502°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Bis[2-(Dimethylamino)Phenyl]Urea |