|
CAS#: 952664-81-2 Product: 2-tert-butyl-1-methyl-5-nitro-indole No suppilers available for the product. |
| Name | 2-tert-butyl-1-methyl-5-nitro-indole |
|---|---|
| Synonyms | 2-tert-butyl-1-methyl-5-nitro-1H-indole |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 |
| CAS Registry Number | 952664-81-2 |
| SMILES | CC(C)(C)c1cc2cc(ccc2n1C)[N+](=O)[O-] |
| InChI | 1S/C13H16N2O2/c1-13(2,3)12-8-9-7-10(15(16)17)5-6-11(9)14(12)4/h5-8H,1-4H3 |
| InChIKey | VRGAZLNXPPQBNH-UHFFFAOYSA-N |
| Density | 1.145g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.788°C at 760 mmHg (Cal.) |
| Flash point | 177.442°C (Cal.) |
| Refractive index | 1.572 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-tert-butyl-1-methyl-5-nitro-indole |