|
CAS#: 97038-95-4 Product: 2,4-Dibromo-1-(2,6-Dibromophenyl)Benzene No suppilers available for the product. |
| Name | 2,4-Dibromo-1-(2,6-Dibromophenyl)Benzene |
|---|---|
| Synonyms | 1,1'-Biphenyl, 2,2',4,6'-Tetrabromo-; 2,2',4,6'-Tetrabromo-1,1'-Biphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6Br4 |
| Molecular Weight | 469.80 |
| CAS Registry Number | 97038-95-4 |
| SMILES | C1=C(C(=CC=C1Br)C2=C(C=CC=C2Br)Br)Br |
| InChI | 1S/C12H6Br4/c13-7-4-5-8(11(16)6-7)12-9(14)2-1-3-10(12)15/h1-6H |
| InChIKey | HFDOVSPQVPECFP-UHFFFAOYSA-N |
| Density | 2.141g/cm3 (Cal.) |
|---|---|
| Boiling point | 402.387°C at 760 mmHg (Cal.) |
| Flash point | 191.042°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dibromo-1-(2,6-Dibromophenyl)Benzene |