|
CAS#: 99286-22-3 Product: Dihomo-Prostaglandin I(2) No suppilers available for the product. |
| Name | Dihomo-Prostaglandin I(2) |
|---|---|
| Synonyms | (7E)-7-[(3Ar,4R,5R,6As)-5-Hydroxy-4-[(E,3S)-3-Hydroxyoct-1-Enyl]-3,3A,4,5,6,6A-Hexahydrocyclopenta[D]Furan-2-Ylidene]Enanthic Acid; Dihomo-Prostaglandin I(2); Dihomo-Pgi(2) |
| Molecular Structure | ![]() |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.52 |
| CAS Registry Number | 99286-22-3 |
| SMILES | [C@@H]12[C@@H](OC(/C1)=C/CCCCCC(=O)O)C[C@@H](O)[C@@H]2\C=C\[C@@H](O)CCCCC |
| InChI | 1S/C22H36O5/c1-2-3-6-9-16(23)12-13-18-19-14-17(27-21(19)15-20(18)24)10-7-4-5-8-11-22(25)26/h10,12-13,16,18-21,23-24H,2-9,11,14-15H2,1H3,(H,25,26)/b13-12+,17-10+/t16-,18+,19+,20+,21-/m0/s1 |
| InChIKey | ITVMMMCBRSJVKT-LAALATIFSA-N |
| Density | 1.183g/cm3 (Cal.) |
|---|---|
| Boiling point | 552.575°C at 760 mmHg (Cal.) |
| Flash point | 185.288°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dihomo-Prostaglandin I(2) |