| Ooo Npo Termodinamika 3000 | Russia | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (903) 609-51-94 | |||
![]() |
termodinamika3000@gmail.com | |||
| Chemical manufacturer since 2023 | ||||
| chemBlink standard supplier since 2023 | ||||
| Ooo Npo "ttermodinamika 3000" | Russia | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (903) 609-51-94 | |||
![]() |
termodinamika3000@gmail.com | |||
![]() |
WeChat: +7 (903) 609-51-94 | |||
![]() |
WhatsApp: +7 (903) 609-51-94 | |||
| Chemical manufacturer since 2004 | ||||
| chemBlink standard supplier since 2023 | ||||
| Classification | Chemical reagent >> Organic reagent >> Siloxane |
|---|---|
| Name | Hexachlorodisiloxane |
| Synonyms | Trichloro(trichlorosilyloxy)silane |
| Molecular Structure | ![]() |
| Molecular Formula | Cl6OSi2 |
| Molecular Weight | 284.89 |
| CAS Registry Number | 14986-21-1 |
| EC Number | 239-070-4 |
| SMILES | O([Si](Cl)(Cl)Cl)[Si](Cl)(Cl)Cl |
| Solubility | 3.524 mg/L (25 ºC water) |
|---|---|
| Density | 1.6±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.488, Calc.* |
| Melting point | 229.05 ºC |
| Boiling Point | 549.64 ºC, 136.8±9.0 ºC (760 mmHg), Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Classification | |||||||||||||||||||||||||
| |||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for Hexachlorodisiloxane |