| Henan Ouber Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (371) 6532-2607 +86 18937141980 | |||
![]() |
anna.zhang@oubertec.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18937141980 | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink massive supplier since 2020 | ||||
| Classification | Organic raw materials >> Aryl compounds >> Anilines |
|---|---|
| Name | 4-(Benzo[b]thiophen-2-yl)aniline |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11NS |
| Molecular Weight | 225.31 |
| CAS Registry Number | 54492-95-4 |
| SMILES | C1=CC=C2C(=C1)C=C(S2)C3=CC=C(C=C3)N |
| Solubility | 17.08 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.720, Calc.* |
| Melting point | 153.75 ºC |
| Boiling Point | 413.7±20.0 ºC (760 mmHg), Calc.*, 403.93 ºC |
| Flash Point | 204.0±21.8 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 4-(Benzo[b]thiophen-2-yl)aniline |