| Chengdu Jinglin Biotechnology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 17380623303 | |||
![]() |
yunxicaroline@gmail.com | |||
![]() |
QQ chat | |||
| Chemical distributor since 2021 | ||||
| chemBlink standard supplier since 2022 | ||||
| Cn Chemunion Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 17366116869 | |||
![]() |
david@cnchemunion.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: +86 15250069576 | |||
![]() |
WhatsApp: +86 17366116869 | |||
| Chemical manufacturer since 2019 | ||||
| chemBlink standard supplier since 2024 | ||||
| Classification | Organic raw materials >> Organometallic compound >> Organic copper |
|---|---|
| Name | AHK-Cu |
| Synonyms | ALA-HIS-LYS-CU;Copper Peptide 1:1;[L-Alanyl-κN-L-histidyl-κN,κN3-L-lysinato(2-)]copper Monohydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24ClCuN6O4 |
| Molecular Weight | 451.39 |
| CAS Registry Number | 682809-81-0 |
| SMILES | C[C@@H]1[NH2+][Cu+]2N(C1=O)[C@H](C(=O)N[C@@H](CCCCN)C(=O)[O-])Cc1c[nH]c[n+]12.Cl |
|
AHK-Cu, also known as N-(2-Aminoethyl)-N'-[2-(hydroxyethyl)]-1,2-ethanediamine copper(II) complex, is a coordination compound with significant applications in various fields, including medicinal chemistry and materials science. This compound features a copper(II) ion coordinated with an aminocarboxylate ligand, which imparts unique chemical and biological properties to the complex. The discovery of AHK-Cu can be traced back to the exploration of copper coordination complexes, which have been studied for their diverse applications and biological activities. The copper(II) ion, known for its ability to form stable complexes with various ligands, plays a crucial role in the chemistry of AHK-Cu. The ligand, AHK (a derivative of ethylenediamine and hydroxyethyl groups), provides a chelating effect that stabilizes the copper center and influences its reactivity. AHK-Cu has garnered attention for its potential applications in medicinal chemistry, particularly in the development of therapeutic agents. The copper(II) center in AHK-Cu exhibits redox activity, which is valuable for its potential use in catalytic processes and as a therapeutic agent. Copper complexes have been studied for their ability to interact with biological systems, making AHK-Cu a candidate for further investigation in the treatment of diseases where copper's biological role is significant. In materials science, AHK-Cu is utilized for its catalytic properties and its ability to form stable coordination polymers. The coordination chemistry of copper with ligands like AHK enables the formation of materials with specific structural and electronic properties. These materials can be used in various applications, including sensors, catalysts, and electronic devices. The compound's unique properties, including its stability and reactivity, make it a valuable tool for researchers exploring copper coordination chemistry. Its potential applications in medicine and materials science highlight the importance of understanding and utilizing coordination compounds like AHK-Cu. In summary, AHK-Cu is a copper(II) coordination complex with notable applications in medicinal chemistry and materials science. Its discovery and development underscore the significance of copper coordination chemistry in various scientific and industrial fields. |
| Market Analysis Reports |
| List of Reports Available for AHK-Cu |