|
CAS#: 180301-42-2 Product: (1,3,7-Trimethyl-2,6-Dioxopurin-8-Yl) Diethylaminomethanedithioate No suppilers available for the product. |
| Name | (1,3,7-Trimethyl-2,6-Dioxopurin-8-Yl) Diethylaminomethanedithioate |
|---|---|
| Synonyms | (1,3,7-Trimethyl-2,6-Dioxo-Purin-8-Yl) Diethylaminomethanedithioate; Diethylaminomethanedithioic Acid (1,3,7-Trimethyl-2,6-Dioxo-8-Purinyl) Ester; Diethylaminomethanedithioic Acid (2,6-Diketo-1,3,7-Trimethyl-Purin-8-Yl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C13H19N5O2S2 |
| Molecular Weight | 341.45 |
| CAS Registry Number | 180301-42-2 |
| SMILES | C(N(C(SC1=NC2=C([N]1C)C(N(C(N2C)=O)C)=O)=S)CC)C |
| InChI | 1S/C13H19N5O2S2/c1-6-18(7-2)13(21)22-11-14-9-8(15(11)3)10(19)17(5)12(20)16(9)4/h6-7H2,1-5H3 |
| InChIKey | WHYUBHKOVOCYJI-UHFFFAOYSA-N |
| Density | 1.387g/cm3 (Cal.) |
|---|---|
| Boiling point | 504.244°C at 760 mmHg (Cal.) |
| Flash point | 258.758°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1,3,7-Trimethyl-2,6-Dioxopurin-8-Yl) Diethylaminomethanedithioate |