|
CAS#: 3376-90-7 Product: [3-[(4-Tert-Butylphenoxy)Methyl]-2-Methyl-6-Propylphenyl] Hydrogen Sulfite No suppilers available for the product. |
| Name | [3-[(4-Tert-Butylphenoxy)Methyl]-2-Methyl-6-Propylphenyl] Hydrogen Sulfite |
|---|---|
| Synonyms | [3-[(4-Tert-Butylphenoxy)Methyl]-2-Methyl-6-Propyl-Phenyl] Hydrogen Sulfite; C 940; Ent 27,224 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H28O4S |
| Molecular Weight | 376.51 |
| CAS Registry Number | 3376-90-7 |
| SMILES | C1=C(C(=C(C(=C1)COC2=CC=C(C=C2)C(C)(C)C)C)O[S](=O)O)CCC |
| InChI | 1S/C21H28O4S/c1-6-7-16-8-9-17(15(2)20(16)25-26(22)23)14-24-19-12-10-18(11-13-19)21(3,4)5/h8-13H,6-7,14H2,1-5H3,(H,22,23) |
| InChIKey | DBFUGGKBJXFJMX-UHFFFAOYSA-N |
| Density | 1.173g/cm3 (Cal.) |
|---|---|
| Boiling point | 541.055°C at 760 mmHg (Cal.) |
| Flash point | 281.02°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [3-[(4-Tert-Butylphenoxy)Methyl]-2-Methyl-6-Propylphenyl] Hydrogen Sulfite |