|
CAS#: 3414-66-2 Product: N-[(5-Nitro-1H-Indol-3-Yl)Methyl]-N-Propylpropan-1-Amine No suppilers available for the product. |
| Name | N-[(5-Nitro-1H-Indol-3-Yl)Methyl]-N-Propylpropan-1-Amine |
|---|---|
| Synonyms | N-[(5-Nitro-1H-Indol-3-Yl)Methyl]-N-Propyl-Propan-1-Amine; (5-Nitro-1H-Indol-3-Yl)Methyl-Dipropyl-Amine; 3-((Dipropylamino)Methyl)-5-Nitroindole |
| Molecular Structure | ![]() |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 |
| CAS Registry Number | 3414-66-2 |
| SMILES | C1=C(C=CC2=C1C(=C[NH]2)CN(CCC)CCC)[N+](=O)[O-] |
| InChI | 1S/C15H21N3O2/c1-3-7-17(8-4-2)11-12-10-16-15-6-5-13(18(19)20)9-14(12)15/h5-6,9-10,16H,3-4,7-8,11H2,1-2H3 |
| InChIKey | SDTHSDKPFDQUNP-UHFFFAOYSA-N |
| Density | 1.165g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.355°C at 760 mmHg (Cal.) |
| Flash point | 210.442°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(5-Nitro-1H-Indol-3-Yl)Methyl]-N-Propylpropan-1-Amine |