|
CAS#: 3586-39-8 Product: 2,2,4-Trimethylhexanedioic Acid No suppilers available for the product. |
| Name | 2,2,4-Trimethylhexanedioic Acid |
|---|---|
| Synonyms | 2,2,4-Trimethyladipic Acid; Hexanedioic Acid, 2,2,4-Trimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 |
| CAS Registry Number | 3586-39-8 |
| EINECS | 222-719-0 |
| SMILES | C(C(=O)O)C(C)CC(C(=O)O)(C)C |
| InChI | 1S/C9H16O4/c1-6(4-7(10)11)5-9(2,3)8(12)13/h6H,4-5H2,1-3H3,(H,10,11)(H,12,13) |
| InChIKey | DWFUTNJGNBYHNN-UHFFFAOYSA-N |
| Density | 1.129g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.706°C at 760 mmHg (Cal.) |
| Flash point | 173.45°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,4-Trimethylhexanedioic Acid |