|
CAS#: 455-83-4 Product: Dichlorophenarsine No suppilers available for the product. |
| Name | Dichlorophenarsine |
|---|---|
| Synonyms | 2-Amino-4-Dichloroarsanyl-Phenol; Diclorofenarsina [Inn-Spanish]; Arsonous Dichloride, (3-Amino-4-Hydroxyphenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H6AsCl2NO |
| Molecular Weight | 253.95 |
| CAS Registry Number | 455-83-4 |
| SMILES | C1=C(C=CC(=C1N)O)[As](Cl)Cl |
| InChI | 1S/C6H6AsCl2NO/c8-7(9)4-1-2-6(11)5(10)3-4/h1-3,11H,10H2 |
| InChIKey | GCFPPDBNEBHYGT-UHFFFAOYSA-N |
| Boiling point | 376.983°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 181.793°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dichlorophenarsine |