|
CAS#: 46878-66-4 Product: 2-Hydroxy-N,N-Dimethyl-1,1'-Biphenyl-3-Carboxamide No suppilers available for the product. |
| Name | 2-Hydroxy-N,N-Dimethyl-1,1'-Biphenyl-3-Carboxamide |
|---|---|
| Synonyms | 2-Hydroxy-N,N-Dimethyl-3-Phenyl-Benzamide; 2-Hydroxy-N,N-Dimethyl[1,1'-Biphenyl]-3-Carboxamide; Brn 2650384 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 |
| CAS Registry Number | 46878-66-4 |
| SMILES | C1=CC(=C(C(=C1)C2=CC=CC=C2)O)C(=O)N(C)C |
| InChI | 1S/C15H15NO2/c1-16(2)15(18)13-10-6-9-12(14(13)17)11-7-4-3-5-8-11/h3-10,17H,1-2H3 |
| InChIKey | FFHMRUWVKUUENH-UHFFFAOYSA-N |
| Density | 1.158g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.744°C at 760 mmHg (Cal.) |
| Flash point | 212.492°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Hydroxy-N,N-Dimethyl-1,1'-Biphenyl-3-Carboxamide |