|
CAS#: 53718-30-2 Product: 1-Ethyl-1,3,3-Trimethylindan-5-Ol No suppilers available for the product. |
| Name | 1-Ethyl-1,3,3-Trimethylindan-5-Ol |
|---|---|
| Synonyms | 1-Ethyl-1,3,3-Trimethyl-Indan-5-Ol; 1-Ethyl-1,3,3-Trimethyl-5-Indanol; 1-Ethyl-1,3,3-Trimethylindan-5-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 |
| CAS Registry Number | 53718-30-2 |
| EINECS | 258-719-2 |
| SMILES | C1=CC(=CC2=C1C(CC2(C)C)(CC)C)O |
| InChI | 1S/C14H20O/c1-5-14(4)9-13(2,3)12-8-10(15)6-7-11(12)14/h6-8,15H,5,9H2,1-4H3 |
| InChIKey | ZWXLWYJXJMJPSB-UHFFFAOYSA-N |
| Density | 0.967g/cm3 (Cal.) |
|---|---|
| Boiling point | 300.649°C at 760 mmHg (Cal.) |
| Flash point | 139.63°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Ethyl-1,3,3-Trimethylindan-5-Ol |