|
CAS#: 54960-98-4 Product: 2,4,6-Trimethoxybiphenyl No suppilers available for the product. |
| Name | 2,4,6-Trimethoxybiphenyl |
|---|---|
| Synonyms | 1,1-Biphenyl,2,4,6-trimethoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 |
| CAS Registry Number | 54960-98-4 |
| SMILES | COc1cc(c(c(c1)OC)c2ccccc2)OC |
| InChI | 1S/C15H16O3/c1-16-12-9-13(17-2)15(14(10-12)18-3)11-7-5-4-6-8-11/h4-10H,1-3H3 |
| InChIKey | KDNOIIRLMOZZBO-UHFFFAOYSA-N |
| Density | 1.077g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.197°C at 760 mmHg (Cal.) |
| Flash point | 108.917°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,6-Trimethoxybiphenyl |