|
CAS#: 55591-12-3 Product: 2,3-Dihydro-1,1-Dimethyl-1H-Indene-4-Carboxylic Acid Ethyl Ester No suppilers available for the product. |
| Name | 2,3-Dihydro-1,1-Dimethyl-1H-Indene-4-Carboxylic Acid Ethyl Ester |
|---|---|
| Synonyms | Ethyl 1,1-Dimethylindane-4-Carboxylate; 1,1-Dimethyl-4-Indanecarboxylic Acid Ethyl Ester; 1,1-Dimethylindane-4-Carboxylic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 |
| CAS Registry Number | 55591-12-3 |
| SMILES | C1=CC2=C(C(=C1)C(=O)OCC)CCC2(C)C |
| InChI | 1S/C14H18O2/c1-4-16-13(15)11-6-5-7-12-10(11)8-9-14(12,2)3/h5-7H,4,8-9H2,1-3H3 |
| InChIKey | JAWKNTBIAIQVDD-UHFFFAOYSA-N |
| Density | 1.033g/cm3 (Cal.) |
|---|---|
| Boiling point | 315.776°C at 760 mmHg (Cal.) |
| Flash point | 142.709°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydro-1,1-Dimethyl-1H-Indene-4-Carboxylic Acid Ethyl Ester |