|
CAS#: 55591-23-6 Product: 1,1,2,2,3,3,4,4,5,5,6,6,6-Tridecafluorohexane-1-Sulphonyl Chloride No suppilers available for the product. |
| Name | 1,1,2,2,3,3,4,4,5,5,6,6,6-Tridecafluorohexane-1-Sulphonyl Chloride |
|---|---|
| Synonyms | Nsc292151; 1,1,2,2,3,3,4,4,5,5,6,6,6-Tridecafluorohexane-1-Sulphonyl Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C6ClF13O2S |
| Molecular Weight | 418.56 |
| CAS Registry Number | 55591-23-6 |
| EINECS | 259-717-4 |
| SMILES | O=[S](C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(=O)Cl |
| InChI | 1S/C6ClF13O2S/c7-23(21,22)6(19,20)4(14,15)2(10,11)1(8,9)3(12,13)5(16,17)18 |
| InChIKey | DVRQSALCLMEVIH-UHFFFAOYSA-N |
| Density | 1.811g/cm3 (Cal.) |
|---|---|
| Boiling point | 150.94°C at 760 mmHg (Cal.) |
| Flash point | 45.087°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,2,2,3,3,4,4,5,5,6,6,6-Tridecafluorohexane-1-Sulphonyl Chloride |