|
CAS#: 55914-87-9 Product: Methylaminoazobenzene No suppilers available for the product. |
| Name | Methylaminoazobenzene |
|---|---|
| Synonyms | N-Methyl-2-Phenylazo-Aniline; N-Methyl-2-Phenylazoaniline; Methyl-(2-Phenylazophenyl)Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 |
| CAS Registry Number | 55914-87-9 |
| SMILES | C1=C(C(=CC=C1)NC)N=NC2=CC=CC=C2 |
| InChI | 1S/C13H13N3/c1-14-12-9-5-6-10-13(12)16-15-11-7-3-2-4-8-11/h2-10,14H,1H3 |
| InChIKey | CPKKERYUBQHXOC-UHFFFAOYSA-N |
| Density | 1.066g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.285°C at 760 mmHg (Cal.) |
| Flash point | 177.138°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methylaminoazobenzene |