|
CAS#: 57307-46-7 Product: Dihydro-3-(1,3,5,7-Tetramethyl-2-Octenyl)Furan-2,5-Dione No suppilers available for the product. |
| Name | Dihydro-3-(1,3,5,7-Tetramethyl-2-Octenyl)Furan-2,5-Dione |
|---|---|
| Synonyms | 3-[(E)-1,3,5,7-Tetramethyloct-2-Enyl]Tetrahydrofuran-2,5-Dione; 3-[(E)-1,3,5,7-Tetramethyloct-2-Enyl]Tetrahydrofuran-2,5-Quinone; Dihydro-3-(1,3,5,7-Tetramethyl-2-Octenyl)Furan-2,5-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 |
| CAS Registry Number | 57307-46-7 |
| EINECS | 260-672-8 |
| SMILES | C(/C(=C/C(C1C(OC(=O)C1)=O)C)C)C(CC(C)C)C |
| InChI | 1S/C16H26O3/c1-10(2)6-11(3)7-12(4)8-13(5)14-9-15(17)19-16(14)18/h8,10-11,13-14H,6-7,9H2,1-5H3/b12-8+ |
| InChIKey | SFCLDKUUKKOPQU-XYOKQWHBSA-N |
| Density | 0.995g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.538°C at 760 mmHg (Cal.) |
| Flash point | 164.061°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dihydro-3-(1,3,5,7-Tetramethyl-2-Octenyl)Furan-2,5-Dione |