Online Database of Chemicals from Around the World
|
CAS#: 58344-28-8 Product: 1-(2,4-Dimethoxyphenyl)-4,4-Dimethyl-1-Penten-3-One No suppilers available for the product. |
| Name | 1-(2,4-Dimethoxyphenyl)-4,4-Dimethyl-1-Penten-3-One |
|---|---|
| Synonyms | (E)-1-(2,4-Dimethoxyphenyl)-4,4-Dimethyl-Pent-1-En-3-One; 1-(2,4-Dimethoxyphenyl)-4,4-Dimethyl-1-Penten-3-One; 1-Penten-3-One, 1-(2,4-Dimethoxyphenyl)-4,4-Dimethyl- |
| Molecular Structure |  |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 |
| CAS Registry Number | 58344-28-8 |
| SMILES | C1=C(C(=CC=C1OC)\C=C\C(C(C)(C)C)=O)OC |
| InChI | 1S/C15H20O3/c1-15(2,3)14(16)9-7-11-6-8-12(17-4)10-13(11)18-5/h6-10H,1-5H3/b9-7+ |
| InChIKey | BUSAVRQSFZGWFC-VQHVLOKHSA-N |
| Density | 1.028g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.186°C at 760 mmHg (Cal.) |
| Flash point | 180.083°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,4-Dimethoxyphenyl)-4,4-Dimethyl-1-Penten-3-One |