|
CAS#: 61200-61-1 Product: 2,4,5-Trichloro-3-Thiophenecarboxaldehyde No suppilers available for the product. |
| Name | 2,4,5-Trichloro-3-Thiophenecarboxaldehyde |
|---|---|
| Synonyms | 2,4,5-Trichloro-3-Thiophenecarboxaldehyde; 3-Thiophenecarboxaldehyde, 2,4,5-Trichloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C5HCl3OS |
| Molecular Weight | 215.48 |
| CAS Registry Number | 61200-61-1 |
| SMILES | C1(=C(C(=C(S1)Cl)Cl)C=O)Cl |
| InChI | 1S/C5HCl3OS/c6-3-2(1-9)4(7)10-5(3)8/h1H |
| InChIKey | NTZVFQVGTJRTTF-UHFFFAOYSA-N |
| Density | 1.704g/cm3 (Cal.) |
|---|---|
| Boiling point | 259.827°C at 760 mmHg (Cal.) |
| Flash point | 110.94°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,5-Trichloro-3-Thiophenecarboxaldehyde |