|
CAS#: 6240-55-7 Product: 1,2-Dichloro-3-Nitronaphthalene No suppilers available for the product. |
| Name | 1,2-Dichloro-3-Nitronaphthalene |
|---|---|
| Synonyms | 1,2-Dichloro-3-Nitro-Naphthalene; Ai3-26497; Brn 2118398 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H5Cl2NO2 |
| Molecular Weight | 242.06 |
| CAS Registry Number | 6240-55-7 |
| SMILES | C1=C2C(=C(C(=C1[N+](=O)[O-])Cl)Cl)C=CC=C2 |
| InChI | 1S/C10H5Cl2NO2/c11-9-7-4-2-1-3-6(7)5-8(10(9)12)13(14)15/h1-5H |
| InChIKey | OYLOOSIEVLMIPQ-UHFFFAOYSA-N |
| Density | 1.52g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.342°C at 760 mmHg (Cal.) |
| Flash point | 180.196°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dichloro-3-Nitronaphthalene |