|
CAS#: 6301-99-1 Product: 1-Chloro-2-(Chloro-Difluoro-Methyl)-1,1-Difluoro-Pentan-2-Ol No suppilers available for the product. |
| Name | 1-Chloro-2-(Chloro-Difluoro-Methyl)-1,1-Difluoro-Pentan-2-Ol |
|---|---|
| Synonyms | 1-Chloro-2-(Chloro-Difluoro-Methyl)-1,1-Difluoro-Pentan-2-Ol; Nsc42743 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H8Cl2F4O |
| Molecular Weight | 243.03 |
| CAS Registry Number | 6301-99-1 |
| SMILES | C(CC)C(O)(C(F)(Cl)F)C(F)(F)Cl |
| InChI | 1S/C6H8Cl2F4O/c1-2-3-4(13,5(7,9)10)6(8,11)12/h13H,2-3H2,1H3 |
| InChIKey | XPYOFQOYWRUKKF-UHFFFAOYSA-N |
| Density | 1.431g/cm3 (Cal.) |
|---|---|
| Boiling point | 203.812°C at 760 mmHg (Cal.) |
| Flash point | 77.063°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-2-(Chloro-Difluoro-Methyl)-1,1-Difluoro-Pentan-2-Ol |