|
CAS#: 6784-23-2 Product: N-[4-(4-Nitrophenyl)Sulfonylphenyl]Formamide No suppilers available for the product. |
| Name | N-[4-(4-Nitrophenyl)Sulfonylphenyl]Formamide |
|---|---|
| Synonyms | N-[4-(4-Nitrophenyl)Sulfonylphenyl]Methanamide; Aids-124265; Aids124265 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10N2O5S |
| Molecular Weight | 306.29 |
| CAS Registry Number | 6784-23-2 |
| SMILES | C2=C([S](=O)(=O)C1=CC=C(NC=O)C=C1)C=CC(=C2)[N+]([O-])=O |
| InChI | 1S/C13H10N2O5S/c16-9-14-10-1-5-12(6-2-10)21(19,20)13-7-3-11(4-8-13)15(17)18/h1-9H,(H,14,16) |
| InChIKey | USWQIHLATJXVMT-UHFFFAOYSA-N |
| Density | 1.484g/cm3 (Cal.) |
|---|---|
| Boiling point | 592.287°C at 760 mmHg (Cal.) |
| Flash point | 312.004°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[4-(4-Nitrophenyl)Sulfonylphenyl]Formamide |