|
CAS#: 6946-58-3 Product: 2-Methyl-5-Phenyl-2-Propyl-1,3-Dioxolan-4-One No suppilers available for the product. |
| Name | 2-Methyl-5-Phenyl-2-Propyl-1,3-Dioxolan-4-One |
|---|---|
| Synonyms | Aids-124977; Nsc57338; Nsc 57338 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 |
| CAS Registry Number | 6946-58-3 |
| SMILES | C2=C(C1C(OC(O1)(CCC)C)=O)C=CC=C2 |
| InChI | 1S/C13H16O3/c1-3-9-13(2)15-11(12(14)16-13)10-7-5-4-6-8-10/h4-8,11H,3,9H2,1-2H3 |
| InChIKey | ORTRRAQKJPYUNB-UHFFFAOYSA-N |
| Density | 1.08g/cm3 (Cal.) |
|---|---|
| Boiling point | 332.359°C at 760 mmHg (Cal.) |
| Flash point | 137.178°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-5-Phenyl-2-Propyl-1,3-Dioxolan-4-One |