|
CAS#: 69997-72-4 Product: Manganese (III) Hematoporphyrin No suppilers available for the product. |
| Name | Manganese (III) Hematoporphyrin |
|---|---|
| Synonyms | Manganese (Iii) Hematoporphyrin; Mn(Iii) Hematoporphyrin |
| Molecular Structure | ![]() |
| Molecular Formula | C34H35MnN4O6 |
| Molecular Weight | 650.61 |
| CAS Registry Number | 69997-72-4 |
| SMILES | N1=C4C(=C(C1=CC2=C(C(=C([N-]2)C=C3N=C(C(=C3CCC([O-])=O)C)C=C5[N-]C(=C4)C(=C5C)C(O)C)CCC([O-])=O)C)C(O)C)C.[H+].[Mn+3] |
| InChI | 1S/C34H38N4O6.Mn/c1-15-21(7-9-31(41)42)27-14-28-22(8-10-32(43)44)16(2)24(36-28)12-29-34(20(6)40)18(4)26(38-29)13-30-33(19(5)39)17(3)25(37-30)11-23(15)35-27;/h11-14,19-20,39-40H,7-10H2,1-6H3,(H4,35,36,37,38,41,42,43,44);/q;+3/p-3 |
| InChIKey | DSGJFYJFXDJHCD-UHFFFAOYSA-K |
| Boiling point | 1180.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 667.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Manganese (III) Hematoporphyrin |