|
CAS#: 70007-83-9 Product: Ethyl 4-Methyl-2-Oxo-2H-Pyran-6-Acetate No suppilers available for the product. |
| Name | Ethyl 4-Methyl-2-Oxo-2H-Pyran-6-Acetate |
|---|---|
| Synonyms | 2-(5-Ethyl-4-Methyl-6-Oxo-Pyran-2-Yl)Acetate; 2-(5-Ethyl-4-Methyl-6-Oxo-2-Pyranyl)Acetate; 2-(5-Ethyl-6-Keto-4-Methyl-Pyran-2-Yl)Acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11O4 |
| Molecular Weight | 195.19 |
| CAS Registry Number | 70007-83-9 |
| EINECS | 274-250-6 |
| SMILES | C(C1=CC(=C(C(O1)=O)CC)C)C([O-])=O |
| InChI | 1S/C10H12O4/c1-3-8-6(2)4-7(5-9(11)12)14-10(8)13/h4H,3,5H2,1-2H3,(H,11,12)/p-1 |
| InChIKey | GTNJZADUVFLKSH-UHFFFAOYSA-M |
| Boiling point | 396.323°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 160.059°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 4-Methyl-2-Oxo-2H-Pyran-6-Acetate |