|
CAS#: 70007-84-0 Product: Methyl 4-Methyl-2-Oxo-2H-Pyran-6-Acetate No suppilers available for the product. |
| Name | Methyl 4-Methyl-2-Oxo-2H-Pyran-6-Acetate |
|---|---|
| Synonyms | 2-(4,5-Dimethyl-6-Oxo-Pyran-2-Yl)Acetate; 2-(4,5-Dimethyl-6-Oxo-2-Pyranyl)Acetate; 2-(6-Keto-4,5-Dimethyl-Pyran-2-Yl)Acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9O4 |
| Molecular Weight | 181.17 |
| CAS Registry Number | 70007-84-0 |
| EINECS | 274-251-1 |
| SMILES | C(C1=CC(=C(C(O1)=O)C)C)C([O-])=O |
| InChI | 1S/C9H10O4/c1-5-3-7(4-8(10)11)13-9(12)6(5)2/h3H,4H2,1-2H3,(H,10,11)/p-1 |
| InChIKey | GJTFSTSOVFXWJC-UHFFFAOYSA-M |
| Boiling point | 390.253°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 161.687°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 4-Methyl-2-Oxo-2H-Pyran-6-Acetate |