|
CAS#: 70214-76-5 Product: 6,8-Dimethylnona-3,5-Dien-2-One No suppilers available for the product. |
| Name | 6,8-Dimethylnona-3,5-Dien-2-One |
|---|---|
| Synonyms | 6,8-Dimethylnona-3,5-Dien-2-One |
| Molecular Structure | ![]() |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 |
| CAS Registry Number | 70214-76-5 |
| EINECS | 274-446-1 |
| SMILES | C(\C(=C\C=C\C(=O)C)C)C(C)C |
| InChI | 1S/C11H18O/c1-9(2)8-10(3)6-5-7-11(4)12/h5-7,9H,8H2,1-4H3/b7-5+,10-6+ |
| InChIKey | UEHONTCNOHEQEF-YLNKAEQOSA-N |
| Density | 0.854g/cm3 (Cal.) |
|---|---|
| Boiling point | 246.623°C at 760 mmHg (Cal.) |
| Flash point | 100.138°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,8-Dimethylnona-3,5-Dien-2-One |