|
CAS#: 71712-16-8 Product: 5-Methoxy-6-[1-(4-methoxyphenyl)ethyl]-1,3-benzodioxole No suppilers available for the product. |
| Name | 5-Methoxy-6-[1-(4-methoxyphenyl)ethyl]-1,3-benzodioxole |
|---|---|
| Synonyms | Nsc 350102; Neuro_000183; 1,3-Benzodioxole, 5-Methoxy-6-((1-(4-Methoxyphenyl)Ethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 |
| CAS Registry Number | 71712-16-8 |
| SMILES | C1=C(C(=CC2=C1OCO2)OC)C(C3=CC=C(C=C3)OC)C |
| InChI | 1S/C17H18O4/c1-11(12-4-6-13(18-2)7-5-12)14-8-16-17(21-10-20-16)9-15(14)19-3/h4-9,11H,10H2,1-3H3 |
| InChIKey | NBIHTBVOSDHTJS-UHFFFAOYSA-N |
| Density | 1.167g/cm3 (Cal.) |
|---|---|
| Boiling point | 408.609°C at 760 mmHg (Cal.) |
| Flash point | 139.996°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methoxy-6-[1-(4-methoxyphenyl)ethyl]-1,3-benzodioxole |