|
CAS#: 73747-32-7 Product: 8-(Cyclopentylmethyl)-1,3,7-Trimethylpurine-2,6-Dione No suppilers available for the product. |
| Name | 8-(Cyclopentylmethyl)-1,3,7-Trimethylpurine-2,6-Dione |
|---|---|
| Synonyms | 8-(Cyclopentylmethyl)-1,3,7-Trimethyl-Purine-2,6-Dione; 8-(Cyclopentylmethyl)-1,3,7-Trimethyl-Xanthine; Nciopen2_006784 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 |
| CAS Registry Number | 73747-32-7 |
| SMILES | C(C1=NC2=C([N]1C)C(=O)N(C(=O)N2C)C)C3CCCC3 |
| InChI | 1S/C14H20N4O2/c1-16-10(8-9-6-4-5-7-9)15-12-11(16)13(19)18(3)14(20)17(12)2/h9H,4-8H2,1-3H3 |
| InChIKey | SULCDSJHCRJOLW-UHFFFAOYSA-N |
| Density | 1.371g/cm3 (Cal.) |
|---|---|
| Boiling point | 474.644°C at 760 mmHg (Cal.) |
| Flash point | 240.856°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-(Cyclopentylmethyl)-1,3,7-Trimethylpurine-2,6-Dione |