Online Database of Chemicals from Around the World
|
CAS#: 74417-02-0 Product: 3-Methoxy-5-(4-Methylphenyl)-1,2,4-Triazine No suppilers available for the product. |
| Name | 3-Methoxy-5-(4-Methylphenyl)-1,2,4-Triazine |
|---|---|
| Synonyms | 1,2,4-Triazine, 3-Methoxy-5-(4-Methylphenyl)-; 3-Methoxy-5-(P-Tolyl)-As-Triazine; As-Triazine, 3-Methoxy-5-(P-Tolyl)- |
| Molecular Structure |  |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 |
| CAS Registry Number | 74417-02-0 |
| SMILES | C1=C(N=C(N=N1)OC)C2=CC=C(C=C2)C |
| InChI | 1S/C11H11N3O/c1-8-3-5-9(6-4-8)10-7-12-14-11(13-10)15-2/h3-7H,1-2H3 |
| InChIKey | QPJKVNZTTYCXNQ-UHFFFAOYSA-N |
| Density | 1.152g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.455°C at 760 mmHg (Cal.) |
| Flash point | 133.939°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methoxy-5-(4-Methylphenyl)-1,2,4-Triazine |